C20H24ClN3O3S2 — CID 15989414
[4-(3-chlorophenyl)piperazin-1-yl]-(1-thiophen-2-ylsulfonylpiperidin-3-yl)methanone (PubChem CID 15989414) has the molecular formula C20H24ClN3O3S2 and a molecular weight of 454.02 g/mol. Its IUPAC name is [4-(3-chlorophenyl)piperazin-1-yl]-(1-thiophen-2-ylsulfonylpiperidin-3-yl)methanone.
| Compound Name | [4-(3-chlorophenyl)piperazin-1-yl]-(1-thiophen-2-ylsulfonylpiperidin-3-yl)methanone |
|---|---|
| PubChem CID | 15989414 |
| Molecular Formula | C20H24ClN3O3S2 |
| Molecular Weight | 454.02 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | [4-(3-chlorophenyl)piperazin-1-yl]-(1-thiophen-2-ylsulfonylpiperidin-3-yl)methanone |
| SMILES | O=C(C1CCCN(S(=O)(=O)c2cccs2)C1)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C20H24ClN3O3S2/c21-17-5-1-6-18(14-17)22-9-11-23(12-10-22)20(25)16-4-2-8-24(15-16)29(26,27)19-7-3-13-28-19/h1,3,5-7,13-14,16H,2,4,8-12,15H2 |
| InChIKey | HLDFMGJMWVMRNX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.02 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |