C19H30N4O4S — CID 92679537
(3S)-3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-N,N-dimethylpiperidine-1-sulfonamide (PubChem CID 92679537) has the molecular formula C19H30N4O4S and a molecular weight of 410.54 g/mol. Its IUPAC name is (3S)-3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-N,N-dimethylpiperidine-1-sulfonamide.
| Compound Name | (3S)-3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-N,N-dimethylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 92679537 |
| Molecular Formula | C19H30N4O4S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | (3S)-3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-N,N-dimethylpiperidine-1-sulfonamide |
| SMILES | COc1ccc(N2CCN(C(=O)[C@H]3CCCN(S(=O)(=O)N(C)C)C3)CC2)cc1 |
| InChI | InChI=1S/C19H30N4O4S/c1-20(2)28(25,26)23-10-4-5-16(15-23)19(24)22-13-11-21(12-14-22)17-6-8-18(27-3)9-7-17/h6-9,16H,4-5,10-15H2,1-3H3/t16-/m0/s1 |
| InChIKey | TZNSIQUBUKHSMP-INIZCTEOSA-N |
| XLogP | 0.86 |
| TPSA | 73.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|