C24H30ClN3O5S — CID 126392197
[(3R)-1-(3-chloro-4-methoxyphenyl)sulfonylpiperidin-3-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 126392197) has the molecular formula C24H30ClN3O5S and a molecular weight of 508.04 g/mol. Its IUPAC name is [(3R)-1-(3-chloro-4-methoxyphenyl)sulfonylpiperidin-3-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [(3R)-1-(3-chloro-4-methoxyphenyl)sulfonylpiperidin-3-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 126392197 |
| Molecular Formula | C24H30ClN3O5S |
| Molecular Weight | 508.04 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | [(3R)-1-(3-chloro-4-methoxyphenyl)sulfonylpiperidin-3-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(N2CCN(C(=O)[C@@H]3CCCN(S(=O)(=O)c4ccc(OC)c(Cl)c4)C3)CC2)cc1 |
| InChI | InChI=1S/C24H30ClN3O5S/c1-32-20-7-5-19(6-8-20)26-12-14-27(15-13-26)24(29)18-4-3-11-28(17-18)34(30,31)21-9-10-23(33-2)22(25)16-21/h5-10,16,18H,3-4,11-15,17H2,1-2H3/t18-/m1/s1 |
| InChIKey | AUWTVFNOXOKRKK-GOSISDBHSA-N |
| XLogP | 3.11 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.04 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|