C19H27N3O4S2 — CID 56510993
cyclobutyl-[4-(1-thiophen-2-ylsulfonylpiperidine-4-carbonyl)piperazin-1-yl]methanone (PubChem CID 56510993) has the molecular formula C19H27N3O4S2 and a molecular weight of 425.58 g/mol. Its IUPAC name is cyclobutyl-[4-(1-thiophen-2-ylsulfonylpiperidine-4-carbonyl)piperazin-1-yl]methanone.
| Compound Name | cyclobutyl-[4-(1-thiophen-2-ylsulfonylpiperidine-4-carbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 56510993 |
| Molecular Formula | C19H27N3O4S2 |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | cyclobutyl-[4-(1-thiophen-2-ylsulfonylpiperidine-4-carbonyl)piperazin-1-yl]methanone |
| SMILES | O=C(C1CCC1)N1CCN(C(=O)C2CCN(S(=O)(=O)c3cccs3)CC2)CC1 |
| InChI | InChI=1S/C19H27N3O4S2/c23-18(15-3-1-4-15)20-10-12-21(13-11-20)19(24)16-6-8-22(9-7-16)28(25,26)17-5-2-14-27-17/h2,5,14-16H,1,3-4,6-13H2 |
| InChIKey | ZIPZZLJYHNFOPU-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |