C13H18N2O4S2 — CID 2970302
oxolan-2-yl-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone (PubChem CID 2970302) has the molecular formula C13H18N2O4S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is oxolan-2-yl-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone.
| Compound Name | oxolan-2-yl-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 2970302 |
| Molecular Formula | C13H18N2O4S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | oxolan-2-yl-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone |
| SMILES | O=C(C1CCCO1)N1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C13H18N2O4S2/c16-13(11-3-1-9-19-11)14-5-7-15(8-6-14)21(17,18)12-4-2-10-20-12/h2,4,10-11H,1,3,5-9H2 |
| InChIKey | UDCLYSMALZZYNJ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |