C21H25N3O5S2 — CID 2815642
N-[[5-[4-(oxolane-2-carbonyl)piperazin-1-yl]sulfonylthiophen-2-yl]methyl]benzamide (PubChem CID 2815642) has the molecular formula C21H25N3O5S2 and a molecular weight of 463.58 g/mol. Its IUPAC name is N-[[5-[4-(oxolane-2-carbonyl)piperazin-1-yl]sulfonylthiophen-2-yl]methyl]benzamide.
| Compound Name | N-[[5-[4-(oxolane-2-carbonyl)piperazin-1-yl]sulfonylthiophen-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 2815642 |
| Molecular Formula | C21H25N3O5S2 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | N-[[5-[4-(oxolane-2-carbonyl)piperazin-1-yl]sulfonylthiophen-2-yl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(S(=O)(=O)N2CCN(C(=O)C3CCCO3)CC2)s1)c1ccccc1 |
| InChI | InChI=1S/C21H25N3O5S2/c25-20(16-5-2-1-3-6-16)22-15-17-8-9-19(30-17)31(27,28)24-12-10-23(11-13-24)21(26)18-7-4-14-29-18/h1-3,5-6,8-9,18H,4,7,10-15H2,(H,22,25) |
| InChIKey | UEOAIZHCCPGUJP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |