C24H25N5O4S2 — CID 18382304
N-[[5-[4-(4-carbamimidoylbenzoyl)piperazin-1-yl]sulfonylthiophen-2-yl]methyl]benzamide (PubChem CID 18382304) has the molecular formula C24H25N5O4S2 and a molecular weight of 511.63 g/mol. Its IUPAC name is N-[[5-[4-(4-carbamimidoylbenzoyl)piperazin-1-yl]sulfonylthiophen-2-yl]methyl]benzamide.
| Compound Name | N-[[5-[4-(4-carbamimidoylbenzoyl)piperazin-1-yl]sulfonylthiophen-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 18382304 |
| Molecular Formula | C24H25N5O4S2 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | N-[[5-[4-(4-carbamimidoylbenzoyl)piperazin-1-yl]sulfonylthiophen-2-yl]methyl]benzamide |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)N2CCN(S(=O)(=O)c3ccc(CNC(=O)c4ccccc4)s3)CC2)cc1 |
| InChI | InChI=1S/C24H25N5O4S2/c25-22(26)17-6-8-19(9-7-17)24(31)28-12-14-29(15-13-28)35(32,33)21-11-10-20(34-21)16-27-23(30)18-4-2-1-3-5-18/h1-11H,12-16H2,(H3,25,26)(H,27,30) |
| InChIKey | LHHYEVVOJBOPBH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 136.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|