C16H17FN2O3S2 — CID 17436138
4-fluoro-N-[(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)methyl]benzamide (PubChem CID 17436138) has the molecular formula C16H17FN2O3S2 and a molecular weight of 368.46 g/mol. Its IUPAC name is 4-fluoro-N-[(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)methyl]benzamide.
| Compound Name | 4-fluoro-N-[(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 17436138 |
| Molecular Formula | C16H17FN2O3S2 |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 4-fluoro-N-[(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)methyl]benzamide |
| SMILES | O=C(NCc1ccc(S(=O)(=O)N2CCCC2)s1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H17FN2O3S2/c17-13-5-3-12(4-6-13)16(20)18-11-14-7-8-15(23-14)24(21,22)19-9-1-2-10-19/h3-8H,1-2,9-11H2,(H,18,20) |
| InChIKey | TUONWFNQCWEYRP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |