C16H16ClFN2O3S2 — CID 53112330
3-chloro-4-fluoro-N-[(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)methyl]benzamide (PubChem CID 53112330) has the molecular formula C16H16ClFN2O3S2 and a molecular weight of 402.90 g/mol. Its IUPAC name is 3-chloro-4-fluoro-N-[(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)methyl]benzamide.
| Compound Name | 3-chloro-4-fluoro-N-[(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 53112330 |
| Molecular Formula | C16H16ClFN2O3S2 |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | 3-chloro-4-fluoro-N-[(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)methyl]benzamide |
| SMILES | O=C(NCc1ccc(S(=O)(=O)N2CCCC2)s1)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C16H16ClFN2O3S2/c17-13-9-11(3-5-14(13)18)16(21)19-10-12-4-6-15(24-12)25(22,23)20-7-1-2-8-20/h3-6,9H,1-2,7-8,10H2,(H,19,21) |
| InChIKey | HHASPMNYDNKLCY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |