C16H16F2N2O4S2 — CID 41311320
3,4-difluoro-N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]benzamide (PubChem CID 41311320) has the molecular formula C16H16F2N2O4S2 and a molecular weight of 402.44 g/mol. Its IUPAC name is 3,4-difluoro-N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]benzamide.
| Compound Name | 3,4-difluoro-N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 41311320 |
| Molecular Formula | C16H16F2N2O4S2 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 3,4-difluoro-N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]benzamide |
| SMILES | O=C(NCc1ccc(S(=O)(=O)N2CCOCC2)s1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H16F2N2O4S2/c17-13-3-1-11(9-14(13)18)16(21)19-10-12-2-4-15(25-12)26(22,23)20-5-7-24-8-6-20/h1-4,9H,5-8,10H2,(H,19,21) |
| InChIKey | ZKTVMPPXBNZVLM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |