C19H21N3O6S3 — CID 41322063
N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]-3-(prop-2-ynylsulfamoyl)benzamide (PubChem CID 41322063) has the molecular formula C19H21N3O6S3 and a molecular weight of 483.59 g/mol. Its IUPAC name is N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]-3-(prop-2-ynylsulfamoyl)benzamide.
| Compound Name | N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]-3-(prop-2-ynylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 41322063 |
| Molecular Formula | C19H21N3O6S3 |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.06 |
| IUPAC Name | N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]-3-(prop-2-ynylsulfamoyl)benzamide |
| SMILES | C#CCNS(=O)(=O)c1cccc(C(=O)NCc2ccc(S(=O)(=O)N3CCOCC3)s2)c1 |
| InChI | InChI=1S/C19H21N3O6S3/c1-2-8-21-30(24,25)17-5-3-4-15(13-17)19(23)20-14-16-6-7-18(29-16)31(26,27)22-9-11-28-12-10-22/h1,3-7,13,21H,8-12,14H2,(H,20,23) |
| InChIKey | FGYLZPXIDYCOMU-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|