C19H22N2O5S2 — CID 32742505
N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]-4-prop-2-enoxybenzamide (PubChem CID 32742505) has the molecular formula C19H22N2O5S2 and a molecular weight of 422.53 g/mol. Its IUPAC name is N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]-4-prop-2-enoxybenzamide.
| Compound Name | N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]-4-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 32742505 |
| Molecular Formula | C19H22N2O5S2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]-4-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(C(=O)NCc2ccc(S(=O)(=O)N3CCOCC3)s2)cc1 |
| InChI | InChI=1S/C19H22N2O5S2/c1-2-11-26-16-5-3-15(4-6-16)19(22)20-14-17-7-8-18(27-17)28(23,24)21-9-12-25-13-10-21/h2-8H,1,9-14H2,(H,20,22) |
| InChIKey | ZGESKWMQCOJZCC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|