C16H17BrN2O5S2 — CID 32741753
5-bromo-2-hydroxy-N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]benzamide (PubChem CID 32741753) has the molecular formula C16H17BrN2O5S2 and a molecular weight of 461.36 g/mol. Its IUPAC name is 5-bromo-2-hydroxy-N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]benzamide.
| Compound Name | 5-bromo-2-hydroxy-N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 32741753 |
| Molecular Formula | C16H17BrN2O5S2 |
| Molecular Weight | 461.36 g/mol |
| Exact Mass | 459.98 |
| IUPAC Name | 5-bromo-2-hydroxy-N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]benzamide |
| SMILES | O=C(NCc1ccc(S(=O)(=O)N2CCOCC2)s1)c1cc(Br)ccc1O |
| InChI | InChI=1S/C16H17BrN2O5S2/c17-11-1-3-14(20)13(9-11)16(21)18-10-12-2-4-15(25-12)26(22,23)19-5-7-24-8-6-19/h1-4,9,20H,5-8,10H2,(H,18,21) |
| InChIKey | QLEQKJKXFHBTQK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |