C20H21N3O5S2 — CID 55758321
1-methyl-N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]-2-oxoquinoline-4-carboxamide (PubChem CID 55758321) has the molecular formula C20H21N3O5S2 and a molecular weight of 447.54 g/mol. Its IUPAC name is 1-methyl-N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]-2-oxoquinoline-4-carboxamide.
| Compound Name | 1-methyl-N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]-2-oxoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 55758321 |
| Molecular Formula | C20H21N3O5S2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | 1-methyl-N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]-2-oxoquinoline-4-carboxamide |
| SMILES | Cn1c(=O)cc(C(=O)NCc2ccc(S(=O)(=O)N3CCOCC3)s2)c2ccccc21 |
| InChI | InChI=1S/C20H21N3O5S2/c1-22-17-5-3-2-4-15(17)16(12-18(22)24)20(25)21-13-14-6-7-19(29-14)30(26,27)23-8-10-28-11-9-23/h2-7,12H,8-11,13H2,1H3,(H,21,25) |
| InChIKey | ZJLBCIRLHRUSLP-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |