C18H21ClN2O5S2 — CID 53112407
2-(3-chloro-4-methoxyphenyl)-N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]acetamide (PubChem CID 53112407) has the molecular formula C18H21ClN2O5S2 and a molecular weight of 444.96 g/mol. Its IUPAC name is 2-(3-chloro-4-methoxyphenyl)-N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]acetamide.
| Compound Name | 2-(3-chloro-4-methoxyphenyl)-N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 53112407 |
| Molecular Formula | C18H21ClN2O5S2 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 2-(3-chloro-4-methoxyphenyl)-N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]acetamide |
| SMILES | COc1ccc(CC(=O)NCc2ccc(S(=O)(=O)N3CCOCC3)s2)cc1Cl |
| InChI | InChI=1S/C18H21ClN2O5S2/c1-25-16-4-2-13(10-15(16)19)11-17(22)20-12-14-3-5-18(27-14)28(23,24)21-6-8-26-9-7-21/h2-5,10H,6-9,11-12H2,1H3,(H,20,22) |
| InChIKey | BPPOKAMMLLYOCX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |