C21H25N3O4S2 — CID 86904188
2-(7-ethyl-1H-indol-3-yl)-N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]acetamide (PubChem CID 86904188) has the molecular formula C21H25N3O4S2 and a molecular weight of 447.58 g/mol. Its IUPAC name is 2-(7-ethyl-1H-indol-3-yl)-N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]acetamide.
| Compound Name | 2-(7-ethyl-1H-indol-3-yl)-N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 86904188 |
| Molecular Formula | C21H25N3O4S2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 2-(7-ethyl-1H-indol-3-yl)-N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]acetamide |
| SMILES | CCc1cccc2c(CC(=O)NCc3ccc(S(=O)(=O)N4CCOCC4)s3)c[nH]c12 |
| InChI | InChI=1S/C21H25N3O4S2/c1-2-15-4-3-5-18-16(13-23-21(15)18)12-19(25)22-14-17-6-7-20(29-17)30(26,27)24-8-10-28-11-9-24/h3-7,13,23H,2,8-12,14H2,1H3,(H,22,25) |
| InChIKey | BDPFTBFPHAIYGF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |