About (2,6-dimethylphenyl) 2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetate
(2,6-dimethylphenyl) 2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetate (PubChem CID 8765732) has the molecular formula C18H21NO5S2
and a molecular weight of 395.50 g/mol. Its IUPAC name is (2,6-dimethylphenyl) 2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetate.
Molecular Properties
| Compound Name | (2,6-dimethylphenyl) 2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetate |
| PubChem CID | 8765732 |
| Molecular Formula | C18H21NO5S2 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | (2,6-dimethylphenyl) 2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetate |
| SMILES | Cc1cccc(C)c1OC(=O)Cc1ccc(S(=O)(=O)N2CCOCC2)s1 |
| InChI | InChI=1S/C18H21NO5S2/c1-13-4-3-5-14(2)18(13)24-16(20)12-15-6-7-17(25-15)26(21,22)19-8-10-23-11-9-19/h3-7H,8-12H2,1-2H3 |
| InChIKey | PNXAZHKUALNFCZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,6-dimethylphenyl) 2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-dimethylphenyl) 2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetate?
The IUPAC name of (2,6-dimethylphenyl) 2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetate (CID 8765732) is (2,6-dimethylphenyl) 2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetate.
What is the SMILES notation for (2,6-dimethylphenyl) 2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetate?
The canonical SMILES for (2,6-dimethylphenyl) 2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetate is Cc1cccc(C)c1OC(=O)Cc1ccc(S(=O)(=O)N2CCOCC2)s1.
What is the InChIKey of (2,6-dimethylphenyl) 2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetate?
The InChIKey is PNXAZHKUALNFCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO5S2/c1-13-4-3-5-14(2)18(13)24-16(20)12-15-6-7-17(25-15)26(21,22)19-8-10-23-11-9-19/h3-7H,8-12H2,1-2H3.
What are the key properties of (2,6-dimethylphenyl) 2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetate?
(2,6-dimethylphenyl) 2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetate has a molecular weight of 395.50 g/mol, XLogP of 2.53, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dimethylphenyl) 2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetate is sourced from PubChem (CID 8765732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).