C18H26N2O6S2 — CID 3621047
[2-(azepan-1-yl)-2-oxoethyl] 2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetate (PubChem CID 3621047) has the molecular formula C18H26N2O6S2 and a molecular weight of 430.55 g/mol. Its IUPAC name is [2-(azepan-1-yl)-2-oxoethyl] 2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetate.
| Compound Name | [2-(azepan-1-yl)-2-oxoethyl] 2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetate |
|---|---|
| PubChem CID | 3621047 |
| Molecular Formula | C18H26N2O6S2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | [2-(azepan-1-yl)-2-oxoethyl] 2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetate |
| SMILES | O=C(Cc1ccc(S(=O)(=O)N2CCOCC2)s1)OCC(=O)N1CCCCCC1 |
| InChI | InChI=1S/C18H26N2O6S2/c21-16(19-7-3-1-2-4-8-19)14-26-17(22)13-15-5-6-18(27-15)28(23,24)20-9-11-25-12-10-20/h5-6H,1-4,7-14H2 |
| InChIKey | IZXCLGIFNDPOLW-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |