C24H24N2O7S2 — CID 23995644
[2-oxo-2-(3-phenoxyanilino)ethyl] 2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetate (PubChem CID 23995644) has the molecular formula C24H24N2O7S2 and a molecular weight of 516.60 g/mol. Its IUPAC name is [2-oxo-2-(3-phenoxyanilino)ethyl] 2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetate.
| Compound Name | [2-oxo-2-(3-phenoxyanilino)ethyl] 2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetate |
|---|---|
| PubChem CID | 23995644 |
| Molecular Formula | C24H24N2O7S2 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | [2-oxo-2-(3-phenoxyanilino)ethyl] 2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetate |
| SMILES | O=C(COC(=O)Cc1ccc(S(=O)(=O)N2CCOCC2)s1)Nc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C24H24N2O7S2/c27-22(25-18-5-4-8-20(15-18)33-19-6-2-1-3-7-19)17-32-23(28)16-21-9-10-24(34-21)35(29,30)26-11-13-31-14-12-26/h1-10,15H,11-14,16-17H2,(H,25,27) |
| InChIKey | GNPHQOMKQJHHAO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |