C16H20N2O6S — CID 3569637
[2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] cyclopropanecarboxylate (PubChem CID 3569637) has the molecular formula C16H20N2O6S and a molecular weight of 368.41 g/mol. Its IUPAC name is [2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] cyclopropanecarboxylate.
| Compound Name | [2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 3569637 |
| Molecular Formula | C16H20N2O6S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | [2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] cyclopropanecarboxylate |
| SMILES | O=C(COC(=O)C1CC1)Nc1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C16H20N2O6S/c19-15(11-24-16(20)12-4-5-12)17-13-2-1-3-14(10-13)25(21,22)18-6-8-23-9-7-18/h1-3,10,12H,4-9,11H2,(H,17,19) |
| InChIKey | IKYJJIVQNBIUTB-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |