C23H34N2O6S — CID 23961153
[2-(4-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 4-tert-butylcyclohexane-1-carboxylate (PubChem CID 23961153) has the molecular formula C23H34N2O6S and a molecular weight of 466.60 g/mol. Its IUPAC name is [2-(4-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 4-tert-butylcyclohexane-1-carboxylate.
| Compound Name | [2-(4-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 4-tert-butylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 23961153 |
| Molecular Formula | C23H34N2O6S |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | [2-(4-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 4-tert-butylcyclohexane-1-carboxylate |
| SMILES | CC(C)(C)C1CCC(C(=O)OCC(=O)Nc2ccc(S(=O)(=O)N3CCOCC3)cc2)CC1 |
| InChI | InChI=1S/C23H34N2O6S/c1-23(2,3)18-6-4-17(5-7-18)22(27)31-16-21(26)24-19-8-10-20(11-9-19)32(28,29)25-12-14-30-15-13-25/h8-11,17-18H,4-7,12-16H2,1-3H3,(H,24,26) |
| InChIKey | IJEYISGCSBZTMP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |