C16H20N2O4 — CID 2511135
[2-(4-morpholin-4-ylanilino)-2-oxoethyl] cyclopropanecarboxylate (PubChem CID 2511135) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is [2-(4-morpholin-4-ylanilino)-2-oxoethyl] cyclopropanecarboxylate.
| Compound Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 2511135 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] cyclopropanecarboxylate |
| SMILES | O=C(COC(=O)C1CC1)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C16H20N2O4/c19-15(11-22-16(20)12-1-2-12)17-13-3-5-14(6-4-13)18-7-9-21-10-8-18/h3-6,12H,1-2,7-11H2,(H,17,19) |
| InChIKey | JEJFWRZWYNOSLE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|