C16H22N2O5 — CID 2564028
[2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-ethoxyacetate (PubChem CID 2564028) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-ethoxyacetate.
| Compound Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-ethoxyacetate |
|---|---|
| PubChem CID | 2564028 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-ethoxyacetate |
| SMILES | CCOCC(=O)OCC(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C16H22N2O5/c1-2-21-12-16(20)23-11-15(19)17-13-3-5-14(6-4-13)18-7-9-22-10-8-18/h3-6H,2,7-12H2,1H3,(H,17,19) |
| InChIKey | IHFGPJAXMDLOLA-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|