C22H26N2O5 — CID 2523260
[2-(4-morpholin-4-ylanilino)-2-oxoethyl] 3-(4-methoxyphenyl)propanoate (PubChem CID 2523260) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 3-(4-methoxyphenyl)propanoate.
| Compound Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 2523260 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 3-(4-methoxyphenyl)propanoate |
| SMILES | COc1ccc(CCC(=O)OCC(=O)Nc2ccc(N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C22H26N2O5/c1-27-20-9-2-17(3-10-20)4-11-22(26)29-16-21(25)23-18-5-7-19(8-6-18)24-12-14-28-15-13-24/h2-3,5-10H,4,11-16H2,1H3,(H,23,25) |
| InChIKey | SZIUSFVSBAZSNF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|