C20H22N2O6 — CID 7404874
[2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-hydroxy-5-methoxybenzoate (PubChem CID 7404874) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-hydroxy-5-methoxybenzoate.
| Compound Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-hydroxy-5-methoxybenzoate |
|---|---|
| PubChem CID | 7404874 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-hydroxy-5-methoxybenzoate |
| SMILES | COc1ccc(O)c(C(=O)OCC(=O)Nc2ccc(N3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C20H22N2O6/c1-26-16-6-7-18(23)17(12-16)20(25)28-13-19(24)21-14-2-4-15(5-3-14)22-8-10-27-11-9-22/h2-7,12,23H,8-11,13H2,1H3,(H,21,24) |
| InChIKey | ZBDDQKACPZBHDE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|