C20H23NO5 — CID 7441971
[2-(2,6-diethylanilino)-2-oxoethyl] 2-hydroxy-5-methoxybenzoate (PubChem CID 7441971) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is [2-(2,6-diethylanilino)-2-oxoethyl] 2-hydroxy-5-methoxybenzoate.
| Compound Name | [2-(2,6-diethylanilino)-2-oxoethyl] 2-hydroxy-5-methoxybenzoate |
|---|---|
| PubChem CID | 7441971 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | [2-(2,6-diethylanilino)-2-oxoethyl] 2-hydroxy-5-methoxybenzoate |
| SMILES | CCc1cccc(CC)c1NC(=O)COC(=O)c1cc(OC)ccc1O |
| InChI | InChI=1S/C20H23NO5/c1-4-13-7-6-8-14(5-2)19(13)21-18(23)12-26-20(24)16-11-15(25-3)9-10-17(16)22/h6-11,22H,4-5,12H2,1-3H3,(H,21,23) |
| InChIKey | PJXNWIZYDFUUKO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |