C20H20F3NO4 — CID 7796481
[2-(2,6-diethylanilino)-2-oxoethyl] 4-(trifluoromethoxy)benzoate (PubChem CID 7796481) has the molecular formula C20H20F3NO4 and a molecular weight of 395.38 g/mol. Its IUPAC name is [2-(2,6-diethylanilino)-2-oxoethyl] 4-(trifluoromethoxy)benzoate.
| Compound Name | [2-(2,6-diethylanilino)-2-oxoethyl] 4-(trifluoromethoxy)benzoate |
|---|---|
| PubChem CID | 7796481 |
| Molecular Formula | C20H20F3NO4 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | [2-(2,6-diethylanilino)-2-oxoethyl] 4-(trifluoromethoxy)benzoate |
| SMILES | CCc1cccc(CC)c1NC(=O)COC(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H20F3NO4/c1-3-13-6-5-7-14(4-2)18(13)24-17(25)12-27-19(26)15-8-10-16(11-9-15)28-20(21,22)23/h5-11H,3-4,12H2,1-2H3,(H,24,25) |
| InChIKey | DUKQXXRFMRDLDL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |