C19H18F3NO4 — CID 7796496
[2-oxo-2-(2,4,6-trimethylanilino)ethyl] 4-(trifluoromethoxy)benzoate (PubChem CID 7796496) has the molecular formula C19H18F3NO4 and a molecular weight of 381.35 g/mol. Its IUPAC name is [2-oxo-2-(2,4,6-trimethylanilino)ethyl] 4-(trifluoromethoxy)benzoate.
| Compound Name | [2-oxo-2-(2,4,6-trimethylanilino)ethyl] 4-(trifluoromethoxy)benzoate |
|---|---|
| PubChem CID | 7796496 |
| Molecular Formula | C19H18F3NO4 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | [2-oxo-2-(2,4,6-trimethylanilino)ethyl] 4-(trifluoromethoxy)benzoate |
| SMILES | Cc1cc(C)c(NC(=O)COC(=O)c2ccc(OC(F)(F)F)cc2)c(C)c1 |
| InChI | InChI=1S/C19H18F3NO4/c1-11-8-12(2)17(13(3)9-11)23-16(24)10-26-18(25)14-4-6-15(7-5-14)27-19(20,21)22/h4-9H,10H2,1-3H3,(H,23,24) |
| InChIKey | HLWMVAHYGVTVCZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |