C20H24N2O3 — CID 8534561
[2-oxo-2-(2,4,6-trimethylanilino)ethyl] 4-(dimethylamino)benzoate (PubChem CID 8534561) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is [2-oxo-2-(2,4,6-trimethylanilino)ethyl] 4-(dimethylamino)benzoate.
| Compound Name | [2-oxo-2-(2,4,6-trimethylanilino)ethyl] 4-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 8534561 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | [2-oxo-2-(2,4,6-trimethylanilino)ethyl] 4-(dimethylamino)benzoate |
| SMILES | Cc1cc(C)c(NC(=O)COC(=O)c2ccc(N(C)C)cc2)c(C)c1 |
| InChI | InChI=1S/C20H24N2O3/c1-13-10-14(2)19(15(3)11-13)21-18(23)12-25-20(24)16-6-8-17(9-7-16)22(4)5/h6-11H,12H2,1-5H3,(H,21,23) |
| InChIKey | UABWNGVWTUGMSG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |