C21H23NO3S2 — CID 7744480
[2-oxo-2-(2,4,6-trimethylanilino)ethyl] 4-(1,3-dithiolan-2-yl)benzoate (PubChem CID 7744480) has the molecular formula C21H23NO3S2 and a molecular weight of 401.55 g/mol. Its IUPAC name is [2-oxo-2-(2,4,6-trimethylanilino)ethyl] 4-(1,3-dithiolan-2-yl)benzoate.
| Compound Name | [2-oxo-2-(2,4,6-trimethylanilino)ethyl] 4-(1,3-dithiolan-2-yl)benzoate |
|---|---|
| PubChem CID | 7744480 |
| Molecular Formula | C21H23NO3S2 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | [2-oxo-2-(2,4,6-trimethylanilino)ethyl] 4-(1,3-dithiolan-2-yl)benzoate |
| SMILES | Cc1cc(C)c(NC(=O)COC(=O)c2ccc(C3SCCS3)cc2)c(C)c1 |
| InChI | InChI=1S/C21H23NO3S2/c1-13-10-14(2)19(15(3)11-13)22-18(23)12-25-20(24)16-4-6-17(7-5-16)21-26-8-9-27-21/h4-7,10-11,21H,8-9,12H2,1-3H3,(H,22,23) |
| InChIKey | SLVLJULSSWSXML-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |