C20H21NO3S2 — CID 7744467
[2-(2,4-dimethylanilino)-2-oxoethyl] 4-(1,3-dithiolan-2-yl)benzoate (PubChem CID 7744467) has the molecular formula C20H21NO3S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is [2-(2,4-dimethylanilino)-2-oxoethyl] 4-(1,3-dithiolan-2-yl)benzoate.
| Compound Name | [2-(2,4-dimethylanilino)-2-oxoethyl] 4-(1,3-dithiolan-2-yl)benzoate |
|---|---|
| PubChem CID | 7744467 |
| Molecular Formula | C20H21NO3S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | [2-(2,4-dimethylanilino)-2-oxoethyl] 4-(1,3-dithiolan-2-yl)benzoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)c2ccc(C3SCCS3)cc2)c(C)c1 |
| InChI | InChI=1S/C20H21NO3S2/c1-13-3-8-17(14(2)11-13)21-18(22)12-24-19(23)15-4-6-16(7-5-15)20-25-9-10-26-20/h3-8,11,20H,9-10,12H2,1-2H3,(H,21,22) |
| InChIKey | TTWGVFGYNYOQTD-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |