C18H23NO3S2 — CID 7744492
[2-(cyclohexylamino)-2-oxoethyl] 4-(1,3-dithiolan-2-yl)benzoate (PubChem CID 7744492) has the molecular formula C18H23NO3S2 and a molecular weight of 365.52 g/mol. Its IUPAC name is [2-(cyclohexylamino)-2-oxoethyl] 4-(1,3-dithiolan-2-yl)benzoate.
| Compound Name | [2-(cyclohexylamino)-2-oxoethyl] 4-(1,3-dithiolan-2-yl)benzoate |
|---|---|
| PubChem CID | 7744492 |
| Molecular Formula | C18H23NO3S2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | [2-(cyclohexylamino)-2-oxoethyl] 4-(1,3-dithiolan-2-yl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(C2SCCS2)cc1)NC1CCCCC1 |
| InChI | InChI=1S/C18H23NO3S2/c20-16(19-15-4-2-1-3-5-15)12-22-17(21)13-6-8-14(9-7-13)18-23-10-11-24-18/h6-9,15,18H,1-5,10-12H2,(H,19,20) |
| InChIKey | FKERAZMBSNVNQF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |