C16H18F3NO4 — CID 7796501
[2-(cyclohexylamino)-2-oxoethyl] 4-(trifluoromethoxy)benzoate (PubChem CID 7796501) has the molecular formula C16H18F3NO4 and a molecular weight of 345.32 g/mol. Its IUPAC name is [2-(cyclohexylamino)-2-oxoethyl] 4-(trifluoromethoxy)benzoate.
| Compound Name | [2-(cyclohexylamino)-2-oxoethyl] 4-(trifluoromethoxy)benzoate |
|---|---|
| PubChem CID | 7796501 |
| Molecular Formula | C16H18F3NO4 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | [2-(cyclohexylamino)-2-oxoethyl] 4-(trifluoromethoxy)benzoate |
| SMILES | O=C(COC(=O)c1ccc(OC(F)(F)F)cc1)NC1CCCCC1 |
| InChI | InChI=1S/C16H18F3NO4/c17-16(18,19)24-13-8-6-11(7-9-13)15(22)23-10-14(21)20-12-4-2-1-3-5-12/h6-9,12H,1-5,10H2,(H,20,21) |
| InChIKey | CEQZAUBWHWVTCR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |