C16H19FN2O4 — CID 2634322
[2-(cyclohexylcarbamoylamino)-2-oxoethyl] 4-fluorobenzoate (PubChem CID 2634322) has the molecular formula C16H19FN2O4 and a molecular weight of 322.34 g/mol. Its IUPAC name is [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 4-fluorobenzoate.
| Compound Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 2634322 |
| Molecular Formula | C16H19FN2O4 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 4-fluorobenzoate |
| SMILES | O=C(COC(=O)c1ccc(F)cc1)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C16H19FN2O4/c17-12-8-6-11(7-9-12)15(21)23-10-14(20)19-16(22)18-13-4-2-1-3-5-13/h6-9,13H,1-5,10H2,(H2,18,19,20,22) |
| InChIKey | UGJIMOPQYOKXMY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |