C19H26N2O7 — CID 8013227
[2-(cyclohexylcarbamoylamino)-2-oxoethyl] 3,4,5-trimethoxybenzoate (PubChem CID 8013227) has the molecular formula C19H26N2O7 and a molecular weight of 394.42 g/mol. Its IUPAC name is [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 8013227 |
| Molecular Formula | C19H26N2O7 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)NC(=O)NC2CCCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C19H26N2O7/c1-25-14-9-12(10-15(26-2)17(14)27-3)18(23)28-11-16(22)21-19(24)20-13-7-5-4-6-8-13/h9-10,13H,4-8,11H2,1-3H3,(H2,20,21,22,24) |
| InChIKey | FOPJBGDNIDAADU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |