C15H16ClFN2O4 — CID 8620254
[2-(cyclopentylcarbamoylamino)-2-oxoethyl] 5-chloro-2-fluorobenzoate (PubChem CID 8620254) has the molecular formula C15H16ClFN2O4 and a molecular weight of 342.75 g/mol. Its IUPAC name is [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 5-chloro-2-fluorobenzoate.
| Compound Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 5-chloro-2-fluorobenzoate |
|---|---|
| PubChem CID | 8620254 |
| Molecular Formula | C15H16ClFN2O4 |
| Molecular Weight | 342.75 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 5-chloro-2-fluorobenzoate |
| SMILES | O=C(COC(=O)c1cc(Cl)ccc1F)NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C15H16ClFN2O4/c16-9-5-6-12(17)11(7-9)14(21)23-8-13(20)19-15(22)18-10-3-1-2-4-10/h5-7,10H,1-4,8H2,(H2,18,19,20,22) |
| InChIKey | GVQXWMRPZOYEMJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.75 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |