C16H18BrFN2O4 — CID 8803511
[2-(cyclohexylcarbamoylamino)-2-oxoethyl] 5-bromo-2-fluorobenzoate (PubChem CID 8803511) has the molecular formula C16H18BrFN2O4 and a molecular weight of 401.23 g/mol. Its IUPAC name is [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 5-bromo-2-fluorobenzoate.
| Compound Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 5-bromo-2-fluorobenzoate |
|---|---|
| PubChem CID | 8803511 |
| Molecular Formula | C16H18BrFN2O4 |
| Molecular Weight | 401.23 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 5-bromo-2-fluorobenzoate |
| SMILES | O=C(COC(=O)c1cc(Br)ccc1F)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C16H18BrFN2O4/c17-10-6-7-13(18)12(8-10)15(22)24-9-14(21)20-16(23)19-11-4-2-1-3-5-11/h6-8,11H,1-5,9H2,(H2,19,20,21,23) |
| InChIKey | IGRAGPCTOBGXIZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.23 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |