C16H19BrN2O4 — CID 3657721
[2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-(4-bromophenyl)acetate (PubChem CID 3657721) has the molecular formula C16H19BrN2O4 and a molecular weight of 383.24 g/mol. Its IUPAC name is [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-(4-bromophenyl)acetate.
| Compound Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-(4-bromophenyl)acetate |
|---|---|
| PubChem CID | 3657721 |
| Molecular Formula | C16H19BrN2O4 |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-(4-bromophenyl)acetate |
| SMILES | O=C(COC(=O)Cc1ccc(Br)cc1)NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C16H19BrN2O4/c17-12-7-5-11(6-8-12)9-15(21)23-10-14(20)19-16(22)18-13-3-1-2-4-13/h5-8,13H,1-4,9-10H2,(H2,18,19,20,22) |
| InChIKey | GAMZZROFFBBODB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |