C16H20BrN3O4 — CID 7149210
[2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-amino-5-bromobenzoate (PubChem CID 7149210) has the molecular formula C16H20BrN3O4 and a molecular weight of 398.26 g/mol. Its IUPAC name is [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-amino-5-bromobenzoate.
| Compound Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-amino-5-bromobenzoate |
|---|---|
| PubChem CID | 7149210 |
| Molecular Formula | C16H20BrN3O4 |
| Molecular Weight | 398.26 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-amino-5-bromobenzoate |
| SMILES | Nc1ccc(Br)cc1C(=O)OCC(=O)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C16H20BrN3O4/c17-10-6-7-13(18)12(8-10)15(22)24-9-14(21)20-16(23)19-11-4-2-1-3-5-11/h6-8,11H,1-5,9,18H2,(H2,19,20,21,23) |
| InChIKey | XJPNGOQEQFFGKI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|