C18H18N2O6 — CID 3903369
[2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-oxochromene-3-carboxylate (PubChem CID 3903369) has the molecular formula C18H18N2O6 and a molecular weight of 358.35 g/mol. Its IUPAC name is [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-oxochromene-3-carboxylate.
| Compound Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 3903369 |
| Molecular Formula | C18H18N2O6 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-oxochromene-3-carboxylate |
| SMILES | O=C(COC(=O)c1cc2ccccc2oc1=O)NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C18H18N2O6/c21-15(20-18(24)19-12-6-2-3-7-12)10-25-16(22)13-9-11-5-1-4-8-14(11)26-17(13)23/h1,4-5,8-9,12H,2-3,6-7,10H2,(H2,19,20,21,24) |
| InChIKey | KRLLZSKILZOWTH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|