C24H22O5 — CID 1280548
[2-(4-cyclohexylphenyl)-2-oxoethyl] 2-oxochromene-3-carboxylate (PubChem CID 1280548) has the molecular formula C24H22O5 and a molecular weight of 390.44 g/mol. Its IUPAC name is [2-(4-cyclohexylphenyl)-2-oxoethyl] 2-oxochromene-3-carboxylate.
| Compound Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 1280548 |
| Molecular Formula | C24H22O5 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] 2-oxochromene-3-carboxylate |
| SMILES | O=C(COC(=O)c1cc2ccccc2oc1=O)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C24H22O5/c25-21(18-12-10-17(11-13-18)16-6-2-1-3-7-16)15-28-23(26)20-14-19-8-4-5-9-22(19)29-24(20)27/h4-5,8-14,16H,1-3,6-7,15H2 |
| InChIKey | HTJLOZMIJVLMFH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|