C22H24O5 — CID 18289518
[2-(4-cyclohexylphenyl)-2-oxoethyl] 2-hydroxy-3-methoxybenzoate (PubChem CID 18289518) has the molecular formula C22H24O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is [2-(4-cyclohexylphenyl)-2-oxoethyl] 2-hydroxy-3-methoxybenzoate.
| Compound Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] 2-hydroxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 18289518 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] 2-hydroxy-3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)OCC(=O)c2ccc(C3CCCCC3)cc2)c1O |
| InChI | InChI=1S/C22H24O5/c1-26-20-9-5-8-18(21(20)24)22(25)27-14-19(23)17-12-10-16(11-13-17)15-6-3-2-4-7-15/h5,8-13,15,24H,2-4,6-7,14H2,1H3 |
| InChIKey | HUOTWUDKTPLBSJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |