C16H21NO5 — CID 18075577
[2-(cyclohexylamino)-2-oxoethyl] 2-hydroxy-3-methoxybenzoate (PubChem CID 18075577) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is [2-(cyclohexylamino)-2-oxoethyl] 2-hydroxy-3-methoxybenzoate.
| Compound Name | [2-(cyclohexylamino)-2-oxoethyl] 2-hydroxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 18075577 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | [2-(cyclohexylamino)-2-oxoethyl] 2-hydroxy-3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)OCC(=O)NC2CCCCC2)c1O |
| InChI | InChI=1S/C16H21NO5/c1-21-13-9-5-8-12(15(13)19)16(20)22-10-14(18)17-11-6-3-2-4-7-11/h5,8-9,11,19H,2-4,6-7,10H2,1H3,(H,17,18) |
| InChIKey | BIABHEWDZIDHOW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |