C17H23NO5 — CID 2503827
[2-(cyclohexylamino)-2-oxoethyl] 2,3-dimethoxybenzoate (PubChem CID 2503827) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is [2-(cyclohexylamino)-2-oxoethyl] 2,3-dimethoxybenzoate.
| Compound Name | [2-(cyclohexylamino)-2-oxoethyl] 2,3-dimethoxybenzoate |
|---|---|
| PubChem CID | 2503827 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | [2-(cyclohexylamino)-2-oxoethyl] 2,3-dimethoxybenzoate |
| SMILES | COc1cccc(C(=O)OCC(=O)NC2CCCCC2)c1OC |
| InChI | InChI=1S/C17H23NO5/c1-21-14-10-6-9-13(16(14)22-2)17(20)23-11-15(19)18-12-7-4-3-5-8-12/h6,9-10,12H,3-5,7-8,11H2,1-2H3,(H,18,19) |
| InChIKey | UNISPHVKKOGRQP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |