C23H26O5 — CID 7042563
[2-(4-cyclohexylphenyl)-2-oxoethyl] 2,3-dimethoxybenzoate (PubChem CID 7042563) has the molecular formula C23H26O5 and a molecular weight of 382.46 g/mol. Its IUPAC name is [2-(4-cyclohexylphenyl)-2-oxoethyl] 2,3-dimethoxybenzoate.
| Compound Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] 2,3-dimethoxybenzoate |
|---|---|
| PubChem CID | 7042563 |
| Molecular Formula | C23H26O5 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] 2,3-dimethoxybenzoate |
| SMILES | COc1cccc(C(=O)OCC(=O)c2ccc(C3CCCCC3)cc2)c1OC |
| InChI | InChI=1S/C23H26O5/c1-26-21-10-6-9-19(22(21)27-2)23(25)28-15-20(24)18-13-11-17(12-14-18)16-7-4-3-5-8-16/h6,9-14,16H,3-5,7-8,15H2,1-2H3 |
| InChIKey | YQWKFENWADVJMC-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |