C20H22O8 — CID 2358791
[2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] 2,3-dimethoxybenzoate (PubChem CID 2358791) has the molecular formula C20H22O8 and a molecular weight of 390.39 g/mol. Its IUPAC name is [2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] 2,3-dimethoxybenzoate.
| Compound Name | [2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] 2,3-dimethoxybenzoate |
|---|---|
| PubChem CID | 2358791 |
| Molecular Formula | C20H22O8 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | [2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] 2,3-dimethoxybenzoate |
| SMILES | COc1cc(C(=O)COC(=O)c2cccc(OC)c2OC)cc(OC)c1OC |
| InChI | InChI=1S/C20H22O8/c1-23-15-8-6-7-13(18(15)26-4)20(22)28-11-14(21)12-9-16(24-2)19(27-5)17(10-12)25-3/h6-10H,11H2,1-5H3 |
| InChIKey | PQCZWLLSFZGGCF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |