C23H22O7 — CID 23990915
[2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] 2,3,4-trimethoxybenzoate (PubChem CID 23990915) has the molecular formula C23H22O7 and a molecular weight of 410.42 g/mol. Its IUPAC name is [2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] 2,3,4-trimethoxybenzoate.
| Compound Name | [2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] 2,3,4-trimethoxybenzoate |
|---|---|
| PubChem CID | 23990915 |
| Molecular Formula | C23H22O7 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | [2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] 2,3,4-trimethoxybenzoate |
| SMILES | COc1ccc2cc(C(=O)COC(=O)c3ccc(OC)c(OC)c3OC)ccc2c1 |
| InChI | InChI=1S/C23H22O7/c1-26-17-8-7-14-11-16(6-5-15(14)12-17)19(24)13-30-23(25)18-9-10-20(27-2)22(29-4)21(18)28-3/h5-12H,13H2,1-4H3 |
| InChIKey | DVBWTPIOXRIXCT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |