C22H25NO7 — CID 7433080
[2-[4-(butanoylamino)phenyl]-2-oxoethyl] 2,3,4-trimethoxybenzoate (PubChem CID 7433080) has the molecular formula C22H25NO7 and a molecular weight of 415.44 g/mol. Its IUPAC name is [2-[4-(butanoylamino)phenyl]-2-oxoethyl] 2,3,4-trimethoxybenzoate.
| Compound Name | [2-[4-(butanoylamino)phenyl]-2-oxoethyl] 2,3,4-trimethoxybenzoate |
|---|---|
| PubChem CID | 7433080 |
| Molecular Formula | C22H25NO7 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | [2-[4-(butanoylamino)phenyl]-2-oxoethyl] 2,3,4-trimethoxybenzoate |
| SMILES | CCCC(=O)Nc1ccc(C(=O)COC(=O)c2ccc(OC)c(OC)c2OC)cc1 |
| InChI | InChI=1S/C22H25NO7/c1-5-6-19(25)23-15-9-7-14(8-10-15)17(24)13-30-22(26)16-11-12-18(27-2)21(29-4)20(16)28-3/h7-12H,5-6,13H2,1-4H3,(H,23,25) |
| InChIKey | QABJZVFEAUZUJE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |