C21H24N2O7 — CID 9197884
[2-[3-(ethylcarbamoyl)anilino]-2-oxoethyl] 2,3,4-trimethoxybenzoate (PubChem CID 9197884) has the molecular formula C21H24N2O7 and a molecular weight of 416.43 g/mol. Its IUPAC name is [2-[3-(ethylcarbamoyl)anilino]-2-oxoethyl] 2,3,4-trimethoxybenzoate.
| Compound Name | [2-[3-(ethylcarbamoyl)anilino]-2-oxoethyl] 2,3,4-trimethoxybenzoate |
|---|---|
| PubChem CID | 9197884 |
| Molecular Formula | C21H24N2O7 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | [2-[3-(ethylcarbamoyl)anilino]-2-oxoethyl] 2,3,4-trimethoxybenzoate |
| SMILES | CCNC(=O)c1cccc(NC(=O)COC(=O)c2ccc(OC)c(OC)c2OC)c1 |
| InChI | InChI=1S/C21H24N2O7/c1-5-22-20(25)13-7-6-8-14(11-13)23-17(24)12-30-21(26)15-9-10-16(27-2)19(29-4)18(15)28-3/h6-11H,5,12H2,1-4H3,(H,22,25)(H,23,24) |
| InChIKey | WHHYEGRAMWGTRM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |