C19H17ClFNO4 — CID 8664205
[2-[4-(butanoylamino)phenyl]-2-oxoethyl] 4-chloro-2-fluorobenzoate (PubChem CID 8664205) has the molecular formula C19H17ClFNO4 and a molecular weight of 377.80 g/mol. Its IUPAC name is [2-[4-(butanoylamino)phenyl]-2-oxoethyl] 4-chloro-2-fluorobenzoate.
| Compound Name | [2-[4-(butanoylamino)phenyl]-2-oxoethyl] 4-chloro-2-fluorobenzoate |
|---|---|
| PubChem CID | 8664205 |
| Molecular Formula | C19H17ClFNO4 |
| Molecular Weight | 377.80 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | [2-[4-(butanoylamino)phenyl]-2-oxoethyl] 4-chloro-2-fluorobenzoate |
| SMILES | CCCC(=O)Nc1ccc(C(=O)COC(=O)c2ccc(Cl)cc2F)cc1 |
| InChI | InChI=1S/C19H17ClFNO4/c1-2-3-18(24)22-14-7-4-12(5-8-14)17(23)11-26-19(25)15-9-6-13(20)10-16(15)21/h4-10H,2-3,11H2,1H3,(H,22,24) |
| InChIKey | OKDRXDLCXPZUFK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.80 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |